C11H8O — CID 177498754
(2S,3R,4R,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-trien-5-one (PubChem CID 177498754) has the molecular formula C11H8O and a molecular weight of 156.18 g/mol. Its IUPAC name is (2S,3R,4R,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-trien-5-one.
| Compound Name | (2S,3R,4R,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-trien-5-one |
|---|---|
| PubChem CID | 177498754 |
| Molecular Formula | C11H8O |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (2S,3R,4R,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-trien-5-one |
| SMILES | O=C1[C@H]2[C@H]3c4ccccc4[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C11H8O/c12-11-8-6-4-2-1-3-5(6)7-9(8)10(7)11/h1-4,7-10H/t7-,8+,9-,10-/m0/s1 |
| InChIKey | IHVSXRIUUQUWKW-JXUBOQSCSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |