C22H28ClNO2 — CID 10044909
(1S,8S)-16,16-diethoxy-13,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride (PubChem CID 10044909) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is (1S,8S)-16,16-diethoxy-13,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride.
| Compound Name | (1S,8S)-16,16-diethoxy-13,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
|---|---|
| PubChem CID | 10044909 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (1S,8S)-16,16-diethoxy-13,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
| SMILES | CCOC1(OCC)[C@H]2c3cccc(C)c3[C@H]([n+]3ccccc32)C1(C)C.[Cl-] |
| InChI | InChI=1S/C22H28NO2.ClH/c1-6-24-22(25-7-2)19-16-12-10-11-15(3)18(16)20(21(22,4)5)23-14-9-8-13-17(19)23;/h8-14,19-20H,6-7H2,1-5H3;1H/q+1;/p-1/t19-,20-;/m0./s1 |
| InChIKey | PLSSJGMIHUEAMK-FKLPMGAJSA-M |
| XLogP | 1.13 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|