C22H28ClNO6 — CID 10388399
(1S,8S)-16,16-diethoxy-8,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene perchlorate (PubChem CID 10388399) has the molecular formula C22H28ClNO6 and a molecular weight of 437.92 g/mol. Its IUPAC name is (1S,8S)-16,16-diethoxy-8,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene perchlorate.
| Compound Name | (1S,8S)-16,16-diethoxy-8,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene perchlorate |
|---|---|
| PubChem CID | 10388399 |
| Molecular Formula | C22H28ClNO6 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (1S,8S)-16,16-diethoxy-8,15,15-trimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene perchlorate |
| SMILES | CCOC1(OCC)C(C)(C)[C@@H]2c3ccccc3[C@@]1(C)c1cccc[n+]12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H28NO2.ClHO4/c1-6-24-22(25-7-2)20(3,4)19-16-12-8-9-13-17(16)21(22,5)18-14-10-11-15-23(18)19;2-1(3,4)5/h8-15,19H,6-7H2,1-5H3;(H,2,3,4,5)/q+1;/p-1/t19-,21-;/m0./s1 |
| InChIKey | MGIIFCGKYXOSGI-RQBPZYBGSA-M |
| XLogP | -0.76 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|