C22H26ClNO6 — CID 10433130
(1'S,4S,6S,8'S)-4,6,15',15'-tetramethylspiro[1,3-dioxane-2,16'-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene] perchlorate (PubChem CID 10433130) has the molecular formula C22H26ClNO6 and a molecular weight of 435.90 g/mol. Its IUPAC name is (1'S,4S,6S,8'S)-4,6,15',15'-tetramethylspiro[1,3-dioxane-2,16'-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene] perchlorate.
| Compound Name | (1'S,4S,6S,8'S)-4,6,15',15'-tetramethylspiro[1,3-dioxane-2,16'-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene] perchlorate |
|---|---|
| PubChem CID | 10433130 |
| Molecular Formula | C22H26ClNO6 |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (1'S,4S,6S,8'S)-4,6,15',15'-tetramethylspiro[1,3-dioxane-2,16'-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene] perchlorate |
| SMILES | C[C@H]1C[C@H](C)OC2(O1)[C@H]1c3ccccc3[C@H]([n+]3ccccc31)C2(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H26NO2.ClHO4/c1-14-13-15(2)25-22(24-14)19-16-9-5-6-10-17(16)20(21(22,3)4)23-12-8-7-11-18(19)23;2-1(3,4)5/h5-12,14-15,19-20H,13H2,1-4H3;(H,2,3,4,5)/q+1;/p-1/t14-,15-,19-,20-;/m0./s1 |
| InChIKey | ZKPHYBGECUOWRW-SFTNZMBESA-M |
| XLogP | -0.80 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|