C19H24ClNO6S — CID 10342627
(1R,8S)-14,14-diethoxy-15,15-dimethyl-12-thia-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene perchlorate (PubChem CID 10342627) has the molecular formula C19H24ClNO6S and a molecular weight of 429.92 g/mol. Its IUPAC name is (1R,8S)-14,14-diethoxy-15,15-dimethyl-12-thia-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene perchlorate.
| Compound Name | (1R,8S)-14,14-diethoxy-15,15-dimethyl-12-thia-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene perchlorate |
|---|---|
| PubChem CID | 10342627 |
| Molecular Formula | C19H24ClNO6S |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (1R,8S)-14,14-diethoxy-15,15-dimethyl-12-thia-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene perchlorate |
| SMILES | CCOC1(OCC)[C@H]2c3ccccc3[C@H]([n+]3ccsc32)C1(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H24NO2S.ClHO4/c1-5-21-19(22-6-2)15-13-9-7-8-10-14(13)16(18(19,3)4)20-11-12-23-17(15)20;2-1(3,4)5/h7-12,15-16H,5-6H2,1-4H3;(H,2,3,4,5)/q+1;/p-1/t15-,16-;/m0./s1 |
| InChIKey | FAEIORUBALOAKS-MOGJOVFKSA-M |
| XLogP | -0.88 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|