C14H18O5 — CID 101064555
(1S,8R,9S,10S)-10-ethoxy-9,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol (PubChem CID 101064555) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1S,8R,9S,10S)-10-ethoxy-9,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol.
| Compound Name | (1S,8R,9S,10S)-10-ethoxy-9,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol |
|---|---|
| PubChem CID | 101064555 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1S,8R,9S,10S)-10-ethoxy-9,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-ol |
| SMILES | CCO[C@@]1(OC)[C@H]2O[C@H](c3ccccc32)[C@]1(O)OC |
| InChI | InChI=1S/C14H18O5/c1-4-18-14(17-3)12-10-8-6-5-7-9(10)11(19-12)13(14,15)16-2/h5-8,11-12,15H,4H2,1-3H3/t11-,12+,13+,14+/m1/s1 |
| InChIKey | MRKDIWNWAHREHG-RFGFWPKPSA-N |
| XLogP | 1.53 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|