C14H19NO3 — CID 10514759
N-[1-[(1S,3R)-3-methoxy-1,3-dihydro-2-benzofuran-1-yl]cyclopentyl]hydroxylamine (PubChem CID 10514759) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[1-[(1S,3R)-3-methoxy-1,3-dihydro-2-benzofuran-1-yl]cyclopentyl]hydroxylamine.
| Compound Name | N-[1-[(1S,3R)-3-methoxy-1,3-dihydro-2-benzofuran-1-yl]cyclopentyl]hydroxylamine |
|---|---|
| PubChem CID | 10514759 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[1-[(1S,3R)-3-methoxy-1,3-dihydro-2-benzofuran-1-yl]cyclopentyl]hydroxylamine |
| SMILES | CO[C@@H]1O[C@H](C2(NO)CCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H19NO3/c1-17-13-11-7-3-2-6-10(11)12(18-13)14(15-16)8-4-5-9-14/h2-3,6-7,12-13,15-16H,4-5,8-9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | MNQJRMASJGMDAL-QWHCGFSZSA-N |
| XLogP | 2.69 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|