C14H18O — CID 21433631
spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ol (PubChem CID 21433631) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ol.
| Compound Name | spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ol |
|---|---|
| PubChem CID | 21433631 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ol |
| SMILES | OC1c2ccccc2CC12CCCCC2 |
| InChI | InChI=1S/C14H18O/c15-13-12-7-3-2-6-11(12)10-14(13)8-4-1-5-9-14/h2-3,6-7,13,15H,1,4-5,8-10H2 |
| InChIKey | QKWAVWDTQITXMP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |