C12H16O2 — CID 22216149
(1S,2R)-2-ethyl-3,4-dihydro-1H-naphthalene-1,2-diol (PubChem CID 22216149) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1S,2R)-2-ethyl-3,4-dihydro-1H-naphthalene-1,2-diol.
| Compound Name | (1S,2R)-2-ethyl-3,4-dihydro-1H-naphthalene-1,2-diol |
|---|---|
| PubChem CID | 22216149 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1S,2R)-2-ethyl-3,4-dihydro-1H-naphthalene-1,2-diol |
| SMILES | CC[C@@]1(O)CCc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C12H16O2/c1-2-12(14)8-7-9-5-3-4-6-10(9)11(12)13/h3-6,11,13-14H,2,7-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | JAYDBGMBIZUVNP-NWDGAFQWSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |