C15H26O — CID 162431044
2,2-dimethyl-1,3-dihydroinden-1-ol;ethane (PubChem CID 162431044) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydroinden-1-ol;ethane.
| Compound Name | 2,2-dimethyl-1,3-dihydroinden-1-ol;ethane |
|---|---|
| PubChem CID | 162431044 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydroinden-1-ol;ethane |
| SMILES | CC.CC.CC1(C)Cc2ccccc2C1O |
| InChI | InChI=1S/C11H14O.2C2H6/c1-11(2)7-8-5-3-4-6-9(8)10(11)12;2*1-2/h3-6,10,12H,7H2,1-2H3;2*1-2H3 |
| InChIKey | ZSHDGKIKSHXUAW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |