C10H10Cl2 — CID 146168714
(1R,2R)-1,2-dichloro-2-methyl-1,3-dihydroindene (PubChem CID 146168714) has the molecular formula C10H10Cl2 and a molecular weight of 201.10 g/mol. Its IUPAC name is (1R,2R)-1,2-dichloro-2-methyl-1,3-dihydroindene.
| Compound Name | (1R,2R)-1,2-dichloro-2-methyl-1,3-dihydroindene |
|---|---|
| PubChem CID | 146168714 |
| Molecular Formula | C10H10Cl2 |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | (1R,2R)-1,2-dichloro-2-methyl-1,3-dihydroindene |
| SMILES | C[C@@]1(Cl)Cc2ccccc2[C@H]1Cl |
| InChI | InChI=1S/C10H10Cl2/c1-10(12)6-7-4-2-3-5-8(7)9(10)11/h2-5,9H,6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | WKFKQNZTUJOIGD-NXEZZACHSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|