C17H22 — CID 24941984
(2S,4R,7R,8R)-4,7,8-trimethyltetracyclo[8.4.0.02,7.04,8]tetradeca-1(14),10,12-triene (PubChem CID 24941984) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is (2S,4R,7R,8R)-4,7,8-trimethyltetracyclo[8.4.0.02,7.04,8]tetradeca-1(14),10,12-triene.
| Compound Name | (2S,4R,7R,8R)-4,7,8-trimethyltetracyclo[8.4.0.02,7.04,8]tetradeca-1(14),10,12-triene |
|---|---|
| PubChem CID | 24941984 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (2S,4R,7R,8R)-4,7,8-trimethyltetracyclo[8.4.0.02,7.04,8]tetradeca-1(14),10,12-triene |
| SMILES | C[C@@]12CC[C@]3(C)[C@H](C1)c1ccccc1C[C@]23C |
| InChI | InChI=1S/C17H22/c1-15-8-9-16(2)14(11-15)13-7-5-4-6-12(13)10-17(15,16)3/h4-7,14H,8-11H2,1-3H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | CYGWTDNYVDATHP-QBPKDAKJSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |