C13H18N2 — CID 139512047
(1S)-spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine (PubChem CID 139512047) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1S)-spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine.
| Compound Name | (1S)-spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
|---|---|
| PubChem CID | 139512047 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1S)-spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
| SMILES | N[C@@H]1c2ccccc2CC12CCNCC2 |
| InChI | InChI=1S/C13H18N2/c14-12-11-4-2-1-3-10(11)9-13(12)5-7-15-8-6-13/h1-4,12,15H,5-9,14H2/t12-/m1/s1 |
| InChIKey | ONOKMILZEVKNEA-GFCCVEGCSA-N |
| XLogP | 1.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |