About (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride
(1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride (PubChem CID 169080151) has the molecular formula C13H18ClFN2
and a molecular weight of 256.75 g/mol. Its IUPAC name is (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride |
| PubChem CID | 169080151 |
| Molecular Formula | C13H18ClFN2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1c2cccc(F)c2CC12CCNCC2 |
| InChI | InChI=1S/C13H17FN2.ClH/c14-11-3-1-2-9-10(11)8-13(12(9)15)4-6-16-7-5-13;/h1-3,12,16H,4-8,15H2;1H/t12-;/m1./s1 |
| InChIKey | XATCPSCWUQYVBB-UTONKHPSSA-N |
| XLogP | 2.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride?
The IUPAC name of (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride (CID 169080151) is (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride.
What is the SMILES notation for (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride?
The canonical SMILES for (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride is Cl.N[C@@H]1c2cccc(F)c2CC12CCNCC2.
What is the InChIKey of (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride?
The InChIKey is XATCPSCWUQYVBB-UTONKHPSSA-N. The full InChI is InChI=1S/C13H17FN2.ClH/c14-11-3-1-2-9-10(11)8-13(12(9)15)4-6-16-7-5-13;/h1-3,12,16H,4-8,15H2;1H/t12-;/m1./s1.
What are the key properties of (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride?
(1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride has a molecular weight of 256.75 g/mol, XLogP of 2.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1-amine;hydrochloride is sourced from PubChem (CID 169080151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).