C13H14O4 — CID 15467580
(1S,8R,10S)-10-ethoxy-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one (PubChem CID 15467580) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1S,8R,10S)-10-ethoxy-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one.
| Compound Name | (1S,8R,10S)-10-ethoxy-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 15467580 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1S,8R,10S)-10-ethoxy-10-methoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one |
| SMILES | CCO[C@]1(OC)C(=O)[C@@H]2O[C@H]1c1ccccc12 |
| InChI | InChI=1S/C13H14O4/c1-3-16-13(15-2)11(14)10-8-6-4-5-7-9(8)12(13)17-10/h4-7,10,12H,3H2,1-2H3/t10-,12+,13-/m1/s1 |
| InChIKey | NGOJCDCWHNKLOY-KGYLQXTDSA-N |
| XLogP | 1.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|