C24H30O12S4 — CID 12868730
[15,16,16-tris(methylsulfonyloxymethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl methanesulfonate (PubChem CID 12868730) has the molecular formula C24H30O12S4 and a molecular weight of 638.76 g/mol. Its IUPAC name is [15,16,16-tris(methylsulfonyloxymethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl methanesulfonate.
| Compound Name | [15,16,16-tris(methylsulfonyloxymethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 12868730 |
| Molecular Formula | C24H30O12S4 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.06 |
| IUPAC Name | [15,16,16-tris(methylsulfonyloxymethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1(COS(C)(=O)=O)C2c3ccccc3C(c3ccccc32)C1(COS(C)(=O)=O)COS(C)(=O)=O |
| InChI | InChI=1S/C24H30O12S4/c1-37(25,26)33-13-23(14-34-38(2,27)28)21-17-9-5-7-11-19(17)22(20-12-8-6-10-18(20)21)24(23,15-35-39(3,29)30)16-36-40(4,31)32/h5-12,21-22H,13-16H2,1-4H3 |
| InChIKey | PJBMTLVWUOQRSP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|