C12H16O8S2 — CID 154151348
2-[2-(methylsulfonyloxymethyl)-1,3-benzodioxol-2-yl]ethyl methanesulfonate (PubChem CID 154151348) has the molecular formula C12H16O8S2 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[2-(methylsulfonyloxymethyl)-1,3-benzodioxol-2-yl]ethyl methanesulfonate.
| Compound Name | 2-[2-(methylsulfonyloxymethyl)-1,3-benzodioxol-2-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 154151348 |
| Molecular Formula | C12H16O8S2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[2-(methylsulfonyloxymethyl)-1,3-benzodioxol-2-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1(COS(C)(=O)=O)Oc2ccccc2O1 |
| InChI | InChI=1S/C12H16O8S2/c1-21(13,14)17-8-7-12(9-18-22(2,15)16)19-10-5-3-4-6-11(10)20-12/h3-6H,7-9H2,1-2H3 |
| InChIKey | CLUKSDXRKWQPCV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|