C12H15FO4S — CID 18975752
3-(2-fluoro-2,3-dihydro-1-benzofuran-3-yl)propyl methanesulfonate (PubChem CID 18975752) has the molecular formula C12H15FO4S and a molecular weight of 274.31 g/mol. Its IUPAC name is 3-(2-fluoro-2,3-dihydro-1-benzofuran-3-yl)propyl methanesulfonate.
| Compound Name | 3-(2-fluoro-2,3-dihydro-1-benzofuran-3-yl)propyl methanesulfonate |
|---|---|
| PubChem CID | 18975752 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-(2-fluoro-2,3-dihydro-1-benzofuran-3-yl)propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCC1c2ccccc2OC1F |
| InChI | InChI=1S/C12H15FO4S/c1-18(14,15)16-8-4-6-10-9-5-2-3-7-11(9)17-12(10)13/h2-3,5,7,10,12H,4,6,8H2,1H3 |
| InChIKey | MRQWVRAXFUMBOT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|