C26H36O4S — CID 154449361
9-(3-methyl-3,4-dihydro-2H-chromen-4-yl)nonyl 4-methylbenzenesulfonate (PubChem CID 154449361) has the molecular formula C26H36O4S and a molecular weight of 444.64 g/mol. Its IUPAC name is 9-(3-methyl-3,4-dihydro-2H-chromen-4-yl)nonyl 4-methylbenzenesulfonate.
| Compound Name | 9-(3-methyl-3,4-dihydro-2H-chromen-4-yl)nonyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154449361 |
| Molecular Formula | C26H36O4S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 9-(3-methyl-3,4-dihydro-2H-chromen-4-yl)nonyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCCCC2c3ccccc3OCC2C)cc1 |
| InChI | InChI=1S/C26H36O4S/c1-21-15-17-23(18-16-21)31(27,28)30-19-11-7-5-3-4-6-8-12-24-22(2)20-29-26-14-10-9-13-25(24)26/h9-10,13-18,22,24H,3-8,11-12,19-20H2,1-2H3 |
| InChIKey | VXPGNRMLGSABBM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|