C20H21N3O8S2 — CID 98556680
[(1R,2S,3S,9S,10S,11R)-2-(methylsulfonyloxymethyl)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecan-1-yl]methyl methanesulfonate (PubChem CID 98556680) has the molecular formula C20H21N3O8S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is [(1R,2S,3S,9S,10S,11R)-2-(methylsulfonyloxymethyl)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecan-1-yl]methyl methanesulfonate.
| Compound Name | [(1R,2S,3S,9S,10S,11R)-2-(methylsulfonyloxymethyl)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecan-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 98556680 |
| Molecular Formula | C20H21N3O8S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [(1R,2S,3S,9S,10S,11R)-2-(methylsulfonyloxymethyl)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecan-1-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC12C3C4C5[C@@H]4[C@H](n4c(=O)n(-c6ccccc6)c(=O)n4[C@@H]51)[C@]32COS(C)(=O)=O |
| InChI | InChI=1S/C20H21N3O8S2/c1-32(26,27)30-8-19-14-11-12-13(11)16(20(14,19)9-31-33(2,28)29)23-18(25)21(10-6-4-3-5-7-10)17(24)22(23)15(12)19/h3-7,11-16H,8-9H2,1-2H3/t11?,12-,13?,14?,15+,16+,19+,20?/m1/s1 |
| InChIKey | KYFDQYLNKXMIOW-KUPQMRRFSA-N |
| XLogP | -0.66 |
| TPSA | 135.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|