C21H17Br2N3O2 — CID 98555810
(1R,2R,4S,6R,8S,11R,12S,13R)-5,5-dibromo-16-phenyl-14,16,18-triazaoctacyclo[9.7.0.02,8.02,9.04,6.08,13.010,12.014,18]octadecane-15,17-dione (PubChem CID 98555810) has the molecular formula C21H17Br2N3O2 and a molecular weight of 503.19 g/mol. Its IUPAC name is (1R,2R,4S,6R,8S,11R,12S,13R)-5,5-dibromo-16-phenyl-14,16,18-triazaoctacyclo[9.7.0.02,8.02,9.04,6.08,13.010,12.014,18]octadecane-15,17-dione.
| Compound Name | (1R,2R,4S,6R,8S,11R,12S,13R)-5,5-dibromo-16-phenyl-14,16,18-triazaoctacyclo[9.7.0.02,8.02,9.04,6.08,13.010,12.014,18]octadecane-15,17-dione |
|---|---|
| PubChem CID | 98555810 |
| Molecular Formula | C21H17Br2N3O2 |
| Molecular Weight | 503.19 g/mol |
| Exact Mass | 500.97 |
| IUPAC Name | (1R,2R,4S,6R,8S,11R,12S,13R)-5,5-dibromo-16-phenyl-14,16,18-triazaoctacyclo[9.7.0.02,8.02,9.04,6.08,13.010,12.014,18]octadecane-15,17-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@@H]1[C@@H]3C4C5[C@@]16C[C@H]1[C@@H](C[C@]56[C@H]2[C@@H]43)C1(Br)Br |
| InChI | InChI=1S/C21H17Br2N3O2/c22-21(23)9-6-19-14-11-12-13(11)16(20(14,19)7-10(9)21)26-18(28)24(8-4-2-1-3-5-8)17(27)25(26)15(12)19/h1-5,9-16H,6-7H2/t9-,10+,11?,12+,13-,14?,15-,16-,19-,20+/m1/s1 |
| InChIKey | KDSIPDSSIYSVPH-MDHPIYHGSA-N |
| XLogP | 2.91 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|