C21H21N3O2 — CID 98555898
(1R,2S,8R,11S,12R,13R)-16-phenyl-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione (PubChem CID 98555898) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (1R,2S,8R,11S,12R,13R)-16-phenyl-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione.
| Compound Name | (1R,2S,8R,11S,12R,13R)-16-phenyl-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione |
|---|---|
| PubChem CID | 98555898 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (1R,2S,8R,11S,12R,13R)-16-phenyl-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@@H]1[C@@H]3C4C5[C@@]16CCCCC[C@]56[C@H]2[C@@H]43 |
| InChI | InChI=1S/C21H21N3O2/c25-18-22(11-7-3-1-4-8-11)19(26)24-17-14-12-13(14)16(23(18)24)20-9-5-2-6-10-21(17,20)15(12)20/h1,3-4,7-8,12-17H,2,5-6,9-10H2/t12?,13-,14+,15?,16-,17-,20+,21-/m1/s1 |
| InChIKey | OSSUDFXRHUUKAD-MKCWEBRCSA-N |
| XLogP | 2.35 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |