C16H13N3O2 — CID 100895798
(1R,2R,10R,11R)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione (PubChem CID 100895798) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is (1R,2R,10R,11R)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione.
| Compound Name | (1R,2R,10R,11R)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione |
|---|---|
| PubChem CID | 100895798 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (1R,2R,10R,11R)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C1[C@@H]3C4C5[C@@H]1[C@@H]5C2[C@H]43 |
| InChI | InChI=1S/C16H13N3O2/c20-15-17(6-4-2-1-3-5-6)16(21)19-14-10-7-8-11(12(8)14)13(9(7)10)18(15)19/h1-5,7-14H/t7?,8?,9-,10-,11-,12-,13?,14?/m1/s1 |
| InChIKey | FOVABRXCXSLHGN-CUXBLVMZSA-N |
| XLogP | 0.65 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |