C17H12N4O2 — CID 119079400
(1R,2R,3R,9R,10S,11R,12R,13S)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-1-carbonitrile (PubChem CID 119079400) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is (1R,2R,3R,9R,10S,11R,12R,13S)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-1-carbonitrile.
| Compound Name | (1R,2R,3R,9R,10S,11R,12R,13S)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-1-carbonitrile |
|---|---|
| PubChem CID | 119079400 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (1R,2R,3R,9R,10S,11R,12R,13S)-5,7-dioxo-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-1-carbonitrile |
| SMILES | N#C[C@]12[C@@H]3[C@H]4[C@H]5[C@@H]3[C@H]1[C@@H]5n1c(=O)n(-c3ccccc3)c(=O)n1[C@H]42 |
| InChI | InChI=1S/C17H12N4O2/c18-6-17-11-9-8-10(11)14(17)21-16(23)19(7-4-2-1-3-5-7)15(22)20(21)13(8)12(9)17/h1-5,8-14H/t8-,9+,10-,11+,12+,13-,14-,17+/m1/s1 |
| InChIKey | VMXWMNBAHBHUAA-JNDYUUMISA-N |
| XLogP | 0.54 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |