C16H15N3O2 — CID 98557314
(1S,2S,8R,10S,11S,12S)-10-methyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione (PubChem CID 98557314) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is (1S,2S,8R,10S,11S,12S)-10-methyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione.
| Compound Name | (1S,2S,8R,10S,11S,12S)-10-methyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione |
|---|---|
| PubChem CID | 98557314 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (1S,2S,8R,10S,11S,12S)-10-methyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione |
| SMILES | C[C@@]12C[C@@H]3[C@H]4[C@H]([C@H]1[C@@H]42)n1c(=O)n(-c2ccccc2)c(=O)n13 |
| InChI | InChI=1S/C16H15N3O2/c1-16-7-9-10-11(16)12(16)13(10)19-15(21)17(14(20)18(9)19)8-5-3-2-4-6-8/h2-6,9-13H,7H2,1H3/t9-,10-,11-,12-,13-,16+/m1/s1 |
| InChIKey | SBRHQWZMKIXRKU-AVGDNFBSSA-N |
| XLogP | 1.18 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |