C17H17N3O2 — CID 98557311
(1R,7R,8S,10R)-8,12-dimethyl-4-phenyl-2,4,6-triazatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 98557311) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is (1R,7R,8S,10R)-8,12-dimethyl-4-phenyl-2,4,6-triazatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,7R,8S,10R)-8,12-dimethyl-4-phenyl-2,4,6-triazatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 98557311 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (1R,7R,8S,10R)-8,12-dimethyl-4-phenyl-2,4,6-triazatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | CC1=C[C@@H]2[C@@H]3C[C@]3(C)[C@@H]1n1c(=O)n(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C17H17N3O2/c1-10-8-13-12-9-17(12,2)14(10)20-16(22)18(15(21)19(13)20)11-6-4-3-5-7-11/h3-8,12-14H,9H2,1-2H3/t12-,13+,14+,17-/m0/s1 |
| InChIKey | UOEBARVGVVQSGA-CFAJVAMVSA-N |
| XLogP | 1.88 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|