C18H17N3O3 — CID 98163496
(1S,2S,3R,9R,10S,11R)-12-(methoxymethyl)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione (PubChem CID 98163496) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is (1S,2S,3R,9R,10S,11R)-12-(methoxymethyl)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione.
| Compound Name | (1S,2S,3R,9R,10S,11R)-12-(methoxymethyl)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione |
|---|---|
| PubChem CID | 98163496 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (1S,2S,3R,9R,10S,11R)-12-(methoxymethyl)-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione |
| SMILES | COCC12C3[C@H]4[C@H]3[C@@H]3[C@H]1[C@H]2[C@@H]4n1c(=O)n(-c2ccccc2)c(=O)n13 |
| InChI | InChI=1S/C18H17N3O3/c1-24-7-18-11-9-10(11)15-13(18)12(18)14(9)20-16(22)19(17(23)21(15)20)8-5-3-2-4-6-8/h2-6,9-15H,7H2,1H3/t9-,10-,11?,12-,13+,14-,15-,18?/m1/s1 |
| InChIKey | PUBYPULNWGFBOW-YURFGYCSSA-N |
| XLogP | 0.66 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |