C17H15N3O2 — CID 119079407
(1S,2S,3S,9S,10R,11S,12S,13S)-1-methyl-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-5,7-dione (PubChem CID 119079407) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is (1S,2S,3S,9S,10R,11S,12S,13S)-1-methyl-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-5,7-dione.
| Compound Name | (1S,2S,3S,9S,10R,11S,12S,13S)-1-methyl-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-5,7-dione |
|---|---|
| PubChem CID | 119079407 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (1S,2S,3S,9S,10R,11S,12S,13S)-1-methyl-6-phenyl-4,6,8-triazahexacyclo[7.4.0.02,12.03,11.04,8.010,13]tridecane-5,7-dione |
| SMILES | C[C@@]12[C@H]3[C@H]4[C@H]5[C@@H]3[C@@H]1n1c(=O)n(-c3ccccc3)c(=O)n1[C@@H]5[C@@H]42 |
| InChI | InChI=1S/C17H15N3O2/c1-17-11-9-8-10(11)14(17)20-16(22)18(7-5-3-2-4-6-7)15(21)19(20)13(8)12(9)17/h2-6,8-14H,1H3/t8-,9+,10-,11-,12+,13-,14-,17-/m0/s1 |
| InChIKey | AOQAVNNTXFWYRQ-AQONDNKPSA-N |
| XLogP | 1.04 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |