C28H20N6O4 — CID 119079357
(1S,2S,3R,4R,5R,6R,7S,13R,14S,15S)-10,18-diphenyl-8,10,12,16,18,20-hexazanonacyclo[13.5.2.02,7.02,14.03,6.04,14.05,13.08,12.016,20]docos-21-ene-9,11,17,19-tetrone (PubChem CID 119079357) has the molecular formula C28H20N6O4 and a molecular weight of 504.51 g/mol. Its IUPAC name is (1S,2S,3R,4R,5R,6R,7S,13R,14S,15S)-10,18-diphenyl-8,10,12,16,18,20-hexazanonacyclo[13.5.2.02,7.02,14.03,6.04,14.05,13.08,12.016,20]docos-21-ene-9,11,17,19-tetrone.
| Compound Name | (1S,2S,3R,4R,5R,6R,7S,13R,14S,15S)-10,18-diphenyl-8,10,12,16,18,20-hexazanonacyclo[13.5.2.02,7.02,14.03,6.04,14.05,13.08,12.016,20]docos-21-ene-9,11,17,19-tetrone |
|---|---|
| PubChem CID | 119079357 |
| Molecular Formula | C28H20N6O4 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (1S,2S,3R,4R,5R,6R,7S,13R,14S,15S)-10,18-diphenyl-8,10,12,16,18,20-hexazanonacyclo[13.5.2.02,7.02,14.03,6.04,14.05,13.08,12.016,20]docos-21-ene-9,11,17,19-tetrone |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@H]1C=C[C@H]2[C@]23[C@H]4[C@@H]5[C@H]6[C@@H]4[C@@]12[C@H]6n1c(=O)n(-c2ccccc2)c(=O)n1[C@H]53 |
| InChI | InChI=1S/C28H20N6O4/c35-23-29(13-7-3-1-4-8-13)24(36)32-16-12-11-15(31(23)32)27-19-17-18-20(19)28(16,27)22(18)34-26(38)30(14-9-5-2-6-10-14)25(37)33(34)21(17)27/h1-12,15-22H/t15-,16-,17-,18-,19-,20-,21-,22+,27+,28+/m0/s1 |
| InChIKey | DSOPKOUTFWKLQX-KPMPLJAYSA-N |
| XLogP | 0.87 |
| TPSA | 97.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|