C20H15N3O2 — CID 98556618
(1S,8S,14S,17S)-11-phenyl-9,11,13-triazapentacyclo[6.5.4.02,7.09,13.014,17]heptadeca-2,4,6,15-tetraene-10,12-dione (PubChem CID 98556618) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is (1S,8S,14S,17S)-11-phenyl-9,11,13-triazapentacyclo[6.5.4.02,7.09,13.014,17]heptadeca-2,4,6,15-tetraene-10,12-dione.
| Compound Name | (1S,8S,14S,17S)-11-phenyl-9,11,13-triazapentacyclo[6.5.4.02,7.09,13.014,17]heptadeca-2,4,6,15-tetraene-10,12-dione |
|---|---|
| PubChem CID | 98556618 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (1S,8S,14S,17S)-11-phenyl-9,11,13-triazapentacyclo[6.5.4.02,7.09,13.014,17]heptadeca-2,4,6,15-tetraene-10,12-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@@H]1c3ccccc3[C@@H]2[C@H]2C=C[C@@H]21 |
| InChI | InChI=1S/C20H15N3O2/c24-19-21(12-6-2-1-3-7-12)20(25)23-18-14-9-5-4-8-13(14)17(22(19)23)15-10-11-16(15)18/h1-11,15-18H/t15-,16-,17+,18+/m0/s1 |
| InChIKey | KBUQWNAHXXEYIA-WNRNVDISSA-N |
| XLogP | 2.11 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|