C15H15N3O3 — CID 98163811
(1S,7S)-9-hydroxy-4-phenyl-2,4,6-triazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione (PubChem CID 98163811) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (1S,7S)-9-hydroxy-4-phenyl-2,4,6-triazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione.
| Compound Name | (1S,7S)-9-hydroxy-4-phenyl-2,4,6-triazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 98163811 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (1S,7S)-9-hydroxy-4-phenyl-2,4,6-triazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@@H]1C=C[C@@H]2CC(O)C1 |
| InChI | InChI=1S/C15H15N3O3/c19-13-8-11-6-7-12(9-13)18-15(21)16(14(20)17(11)18)10-4-2-1-3-5-10/h1-7,11-13,19H,8-9H2/t11-,12-/m1/s1 |
| InChIKey | NMAXXBPLFWFCTA-VXGBXAGGSA-N |
| XLogP | 0.61 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|