C16H17N3O3 — CID 16705640
(10R,10aR)-10-hydroxy-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione (PubChem CID 16705640) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (10R,10aR)-10-hydroxy-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione.
| Compound Name | (10R,10aR)-10-hydroxy-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione |
|---|---|
| PubChem CID | 16705640 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (10R,10aR)-10-hydroxy-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1CC=C1CCC[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C16H17N3O3/c20-13-8-4-5-11-9-10-17-15(21)18(12-6-2-1-3-7-12)16(22)19(17)14(11)13/h1-3,6-7,9,13-14,20H,4-5,8,10H2/t13-,14-/m1/s1 |
| InChIKey | WAEACCMTOSVQDO-ZIAGYGMSSA-N |
| XLogP | 0.83 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|