C27H35N3O5 — CID 169192173
(4S,8R,9E,13R)-10-methyl-5-methylidene-16-phenyl-7-oxa-14,16,18-triazatetracyclo[11.7.0.04,8.014,18]icosa-1(20),9-diene-6,15,17-trione;propane;hydrate (PubChem CID 169192173) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is (4S,8R,9E,13R)-10-methyl-5-methylidene-16-phenyl-7-oxa-14,16,18-triazatetracyclo[11.7.0.04,8.014,18]icosa-1(20),9-diene-6,15,17-trione;propane;hydrate.
| Compound Name | (4S,8R,9E,13R)-10-methyl-5-methylidene-16-phenyl-7-oxa-14,16,18-triazatetracyclo[11.7.0.04,8.014,18]icosa-1(20),9-diene-6,15,17-trione;propane;hydrate |
|---|---|
| PubChem CID | 169192173 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (4S,8R,9E,13R)-10-methyl-5-methylidene-16-phenyl-7-oxa-14,16,18-triazatetracyclo[11.7.0.04,8.014,18]icosa-1(20),9-diene-6,15,17-trione;propane;hydrate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC[C@@H]3C(=CCn4c(=O)n(-c5ccccc5)c(=O)n43)CC[C@@H]12.CCC.O |
| InChI | InChI=1S/C24H25N3O4.C3H8.H2O/c1-15-8-11-20-17(9-10-19-16(2)22(28)31-21(19)14-15)12-13-25-23(29)26(24(30)27(20)25)18-6-4-3-5-7-18;1-3-2;/h3-7,12,14,19-21H,2,8-11,13H2,1H3;3H2,1-2H3;1H2/b15-14+;;/t19-,20+,21+;;/m0../s1 |
| InChIKey | BQRYVYVEYQBEAO-QSRZKWTNSA-N |
| XLogP | 3.49 |
| TPSA | 106.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|