C21H28O4 — CID 167538122
(1R,3E,5S,9R,12E)-3,12-dimethyl-8,17-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,12,16(19)-trien-7-one;hydrate (PubChem CID 167538122) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1R,3E,5S,9R,12E)-3,12-dimethyl-8,17-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,12,16(19)-trien-7-one;hydrate.
| Compound Name | (1R,3E,5S,9R,12E)-3,12-dimethyl-8,17-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,12,16(19)-trien-7-one;hydrate |
|---|---|
| PubChem CID | 167538122 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (1R,3E,5S,9R,12E)-3,12-dimethyl-8,17-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,12,16(19)-trien-7-one;hydrate |
| SMILES | C=C1O[C@H]2C=C1CC/C=C(\C)CC[C@@H]1C(=C)C(=O)O[C@H]1/C=C(\C)C2.O |
| InChI | InChI=1S/C21H26O3.H2O/c1-13-6-5-7-17-12-18(23-16(17)4)10-14(2)11-20-19(9-8-13)15(3)21(22)24-20;/h6,11-12,18-20H,3-5,7-10H2,1-2H3;1H2/b13-6+,14-11+;/t18-,19-,20+;/m1./s1 |
| InChIKey | PRWZRVWXPOPTKT-FXUXFINESA-N |
| XLogP | 3.96 |
| TPSA | 67.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|