C15H18O3 — CID 162996083
(3aS,6E,10Z,11aS)-6,10-dimethyl-3-methylidene-4,5,8,11a-tetrahydro-3aH-cyclodeca[b]furan-2,9-dione (PubChem CID 162996083) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3aS,6E,10Z,11aS)-6,10-dimethyl-3-methylidene-4,5,8,11a-tetrahydro-3aH-cyclodeca[b]furan-2,9-dione.
| Compound Name | (3aS,6E,10Z,11aS)-6,10-dimethyl-3-methylidene-4,5,8,11a-tetrahydro-3aH-cyclodeca[b]furan-2,9-dione |
|---|---|
| PubChem CID | 162996083 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (3aS,6E,10Z,11aS)-6,10-dimethyl-3-methylidene-4,5,8,11a-tetrahydro-3aH-cyclodeca[b]furan-2,9-dione |
| SMILES | C=C1C(=O)O[C@H]2/C=C(/C)C(=O)C/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C15H18O3/c1-9-4-6-12-11(3)15(17)18-14(12)8-10(2)13(16)7-5-9/h5,8,12,14H,3-4,6-7H2,1-2H3/b9-5+,10-8-/t12-,14-/m0/s1 |
| InChIKey | SSRIXHPLUYPDEB-MNMLHNCBSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|