C23H27NO4 — CID 68957008
[(3aR,6Z,10E,11aR)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-yl]methyl-benzylcarbamic acid (PubChem CID 68957008) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [(3aR,6Z,10E,11aR)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-yl]methyl-benzylcarbamic acid.
| Compound Name | [(3aR,6Z,10E,11aR)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-yl]methyl-benzylcarbamic acid |
|---|---|
| PubChem CID | 68957008 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [(3aR,6Z,10E,11aR)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-yl]methyl-benzylcarbamic acid |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\CN(Cc3ccccc3)C(=O)O)CC[C@H]12 |
| InChI | InChI=1S/C23H27NO4/c1-16-7-6-10-19(11-12-20-17(2)22(25)28-21(20)13-16)15-24(23(26)27)14-18-8-4-3-5-9-18/h3-5,8-10,13,20-21H,2,6-7,11-12,14-15H2,1H3,(H,26,27)/b16-13+,19-10-/t20-,21-/m1/s1 |
| InChIKey | VNKBKLCBXFSAND-WZHKHFHHSA-N |
| XLogP | 4.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|