C18H25NO4 — CID 24945058
(3aR,6E,11aS)-N-(2-methoxyethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide (PubChem CID 24945058) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (3aR,6E,11aS)-N-(2-methoxyethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide.
| Compound Name | (3aR,6E,11aS)-N-(2-methoxyethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide |
|---|---|
| PubChem CID | 24945058 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (3aR,6E,11aS)-N-(2-methoxyethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide |
| SMILES | C=C1C(=O)O[C@H]2C=C(C)CC/C=C(/C(=O)NCCOC)CC[C@H]12 |
| InChI | InChI=1S/C18H25NO4/c1-12-5-4-6-14(17(20)19-9-10-22-3)7-8-15-13(2)18(21)23-16(15)11-12/h6,11,15-16H,2,4-5,7-10H2,1,3H3,(H,19,20)/b12-11?,14-6+/t15-,16+/m1/s1 |
| InChIKey | HCJIPONVCQQNQA-JUKKHQLHSA-N |
| XLogP | 2.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|