C14H17N3O5 — CID 139191961
(5R,6S,7R)-6,7-dihydroxy-6-(hydroxymethyl)-5-methyl-2-phenyl-7,8-dihydro-5H-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione (PubChem CID 139191961) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is (5R,6S,7R)-6,7-dihydroxy-6-(hydroxymethyl)-5-methyl-2-phenyl-7,8-dihydro-5H-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione.
| Compound Name | (5R,6S,7R)-6,7-dihydroxy-6-(hydroxymethyl)-5-methyl-2-phenyl-7,8-dihydro-5H-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
|---|---|
| PubChem CID | 139191961 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (5R,6S,7R)-6,7-dihydroxy-6-(hydroxymethyl)-5-methyl-2-phenyl-7,8-dihydro-5H-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
| SMILES | C[C@H]1n2c(=O)n(-c3ccccc3)c(=O)n2C[C@@H](O)[C@@]1(O)CO |
| InChI | InChI=1S/C14H17N3O5/c1-9-14(22,8-18)11(19)7-15-12(20)16(13(21)17(9)15)10-5-3-2-4-6-10/h2-6,9,11,18-19,22H,7-8H2,1H3/t9-,11-,14-/m1/s1 |
| InChIKey | QAZDSGRDPOJGNR-GLXFQSAKSA-N |
| XLogP | -1.54 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |