C20H18BrN3O3 — CID 125035473
(1S,2S,4R,5R,7S,8R,9R,10S,11S,12S)-4-bromo-5-hydroxy-15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadecane-14,16-dione (PubChem CID 125035473) has the molecular formula C20H18BrN3O3 and a molecular weight of 428.29 g/mol. Its IUPAC name is (1S,2S,4R,5R,7S,8R,9R,10S,11S,12S)-4-bromo-5-hydroxy-15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadecane-14,16-dione.
| Compound Name | (1S,2S,4R,5R,7S,8R,9R,10S,11S,12S)-4-bromo-5-hydroxy-15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadecane-14,16-dione |
|---|---|
| PubChem CID | 125035473 |
| Molecular Formula | C20H18BrN3O3 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | (1S,2S,4R,5R,7S,8R,9R,10S,11S,12S)-4-bromo-5-hydroxy-15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadecane-14,16-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@H]1[C@H]3[C@@H]4[C@@H]3[C@H]2[C@]23C[C@@H](Br)[C@H](O)C[C@@]12[C@@H]43 |
| InChI | InChI=1S/C20H18BrN3O3/c21-9-6-19-14-11-12-13(11)16(20(14,19)7-10(9)25)24-18(27)22(8-4-2-1-3-5-8)17(26)23(24)15(12)19/h1-5,9-16,25H,6-7H2/t9-,10-,11+,12+,13+,14+,15+,16+,19-,20-/m1/s1 |
| InChIKey | PPEJIKFWQLVNPP-OTLVIJGASA-N |
| XLogP | 1.31 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|