C27H26N4O2 — CID 98556681
(1S,2R,8R,11R,12S,13S)-5-benzyl-16-phenyl-5,14,16,18-tetrazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione (PubChem CID 98556681) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (1S,2R,8R,11R,12S,13S)-5-benzyl-16-phenyl-5,14,16,18-tetrazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione.
| Compound Name | (1S,2R,8R,11R,12S,13S)-5-benzyl-16-phenyl-5,14,16,18-tetrazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione |
|---|---|
| PubChem CID | 98556681 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (1S,2R,8R,11R,12S,13S)-5-benzyl-16-phenyl-5,14,16,18-tetrazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@H]1[C@@H]3C4C5[C@@]16CCN(Cc1ccccc1)CC[C@@]56[C@@H]2[C@@H]43 |
| InChI | InChI=1S/C27H26N4O2/c32-24-29(17-9-5-2-6-10-17)25(33)31-23-20-18-19(20)22(30(24)31)26-11-13-28(14-12-27(23,26)21(18)26)15-16-7-3-1-4-8-16/h1-10,18-23H,11-15H2/t18?,19-,20+,21?,22-,23-,26-,27-/m0/s1 |
| InChIKey | CKKYAHQBURBLEC-MHLVMBKRSA-N |
| XLogP | 2.68 |
| TPSA | 52.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |