C22H25N3O2 — CID 26143670
1,8-dibenzyl-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26143670) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1,8-dibenzyl-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1,8-dibenzyl-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26143670 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1,8-dibenzyl-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(Cc2ccccc2)C2(CCN(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C22H25N3O2/c1-23-20(26)22(25(21(23)27)17-19-10-6-3-7-11-19)12-14-24(15-13-22)16-18-8-4-2-5-9-18/h2-11H,12-17H2,1H3 |
| InChIKey | ARJYDNMHJWZQOP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|