C20H23N5O3 — CID 165422795
1-benzyl-8-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165422795) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-benzyl-8-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165422795 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-benzyl-8-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(Cc2ccccc2)C2(CCN(c3noc(C4CC4)n3)CC2)C1=O |
| InChI | InChI=1S/C20H23N5O3/c1-23-17(26)20(25(19(23)27)13-14-5-3-2-4-6-14)9-11-24(12-10-20)18-21-16(28-22-18)15-7-8-15/h2-6,15H,7-13H2,1H3 |
| InChIKey | MAYDEDRUBWXZHR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|