C15H15N3O5 — CID 56925303
ethyl (2R,3S,5R)-8,10-dioxo-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-2-carboxylate (PubChem CID 56925303) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is ethyl (2R,3S,5R)-8,10-dioxo-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-2-carboxylate.
| Compound Name | ethyl (2R,3S,5R)-8,10-dioxo-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-2-carboxylate |
|---|---|
| PubChem CID | 56925303 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethyl (2R,3S,5R)-8,10-dioxo-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2O[C@@H]2Cn2c(=O)n(-c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C15H15N3O5/c1-2-22-13(19)11-12-10(23-12)8-16-14(20)17(15(21)18(11)16)9-6-4-3-5-7-9/h3-7,10-12H,2,8H2,1H3/t10-,11-,12-/m1/s1 |
| InChIKey | LXMPXLJLIVMNLF-IJLUTSLNSA-N |
| XLogP | -0.31 |
| TPSA | 87.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|