C20H23N3O2Si — CID 102472373
(5R,6S)-6-[dimethyl(phenyl)silyl]-5-methyl-2-phenyl-6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazole-1,3-dione (PubChem CID 102472373) has the molecular formula C20H23N3O2Si and a molecular weight of 365.51 g/mol. Its IUPAC name is (5R,6S)-6-[dimethyl(phenyl)silyl]-5-methyl-2-phenyl-6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazole-1,3-dione.
| Compound Name | (5R,6S)-6-[dimethyl(phenyl)silyl]-5-methyl-2-phenyl-6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazole-1,3-dione |
|---|---|
| PubChem CID | 102472373 |
| Molecular Formula | C20H23N3O2Si |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (5R,6S)-6-[dimethyl(phenyl)silyl]-5-methyl-2-phenyl-6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazole-1,3-dione |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)c2ccccc2)Cn2c(=O)n(-c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C20H23N3O2Si/c1-15-18(26(2,3)17-12-8-5-9-13-17)14-21-19(24)22(20(25)23(15)21)16-10-6-4-7-11-16/h4-13,15,18H,14H2,1-3H3/t15-,18+/m1/s1 |
| InChIKey | FHKGWOFWPHQCGK-QAPCUYQASA-N |
| XLogP | 2.36 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|