C22H21N3O6 — CID 164683105
(2S)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-8,10-dione (PubChem CID 164683105) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is (2S)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-8,10-dione.
| Compound Name | (2S)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-8,10-dione |
|---|---|
| PubChem CID | 164683105 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (2S)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-9-phenyl-4-oxa-1,7,9-triazatricyclo[5.3.0.03,5]decane-8,10-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1CC1OC1[C@H]2[C@@H]1O[C@H](c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C22H21N3O6/c26-15-12-29-20(13-7-3-1-4-8-13)31-18(15)17-19-16(30-19)11-23-21(27)24(22(28)25(17)23)14-9-5-2-6-10-14/h1-10,15-20,26H,11-12H2/t15-,16?,17-,18-,19?,20-/m1/s1 |
| InChIKey | BNQDIVNXUJVJGW-CHTWOCIJSA-N |
| XLogP | 0.60 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|