C20H26N2O8 — CID 164683109
diethyl (1S,2S,6R)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-7-oxa-3,4-diazabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 164683109) has the molecular formula C20H26N2O8 and a molecular weight of 422.43 g/mol. Its IUPAC name is diethyl (1S,2S,6R)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-7-oxa-3,4-diazabicyclo[4.1.0]heptane-3,4-dicarboxylate.
| Compound Name | diethyl (1S,2S,6R)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-7-oxa-3,4-diazabicyclo[4.1.0]heptane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 164683109 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | diethyl (1S,2S,6R)-2-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-7-oxa-3,4-diazabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | CCOC(=O)N1C[C@H]2O[C@H]2[C@@H]([C@@H]2O[C@H](c3ccccc3)OC[C@H]2O)N1C(=O)OCC |
| InChI | InChI=1S/C20H26N2O8/c1-3-26-19(24)21-10-14-17(29-14)15(22(21)20(25)27-4-2)16-13(23)11-28-18(30-16)12-8-6-5-7-9-12/h5-9,13-18,23H,3-4,10-11H2,1-2H3/t13-,14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | MWXUHEHSGXUDMK-TYENPDHQSA-N |
| XLogP | 1.44 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|