C22H28O7 — CID 177445588
ethyl 2-[[(1S,3R,8S,10R,12S,13R)-12-ethenyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]acetate (PubChem CID 177445588) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is ethyl 2-[[(1S,3R,8S,10R,12S,13R)-12-ethenyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(1S,3R,8S,10R,12S,13R)-12-ethenyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]acetate |
|---|---|
| PubChem CID | 177445588 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | ethyl 2-[[(1S,3R,8S,10R,12S,13R)-12-ethenyl-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy]acetate |
| SMILES | C=C[C@@H]1O[C@@H]2C[C@@H]3OC(c4ccccc4)OC[C@H]3O[C@H]2C[C@H]1OCC(=O)OCC |
| InChI | InChI=1S/C22H28O7/c1-3-15-16(25-13-21(23)24-4-2)10-17-18(27-15)11-19-20(28-17)12-26-22(29-19)14-8-6-5-7-9-14/h3,5-9,15-20,22H,1,4,10-13H2,2H3/t15-,16+,17-,18+,19-,20+,22?/m0/s1 |
| InChIKey | VNQRRTNVGIPYEZ-WCEOIYHYSA-N |
| XLogP | 2.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|