C19H24O3 — CID 16724445
(2R,4aR,6R,7R,8aS)-7-ethenoxy-2-phenyl-6-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine (PubChem CID 16724445) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8aS)-7-ethenoxy-2-phenyl-6-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine.
| Compound Name | (2R,4aR,6R,7R,8aS)-7-ethenoxy-2-phenyl-6-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine |
|---|---|
| PubChem CID | 16724445 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2R,4aR,6R,7R,8aS)-7-ethenoxy-2-phenyl-6-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine |
| SMILES | C=CC[C@@H]1C[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2C[C@H]1OC=C |
| InChI | InChI=1S/C19H24O3/c1-3-8-15-11-16-13-21-19(14-9-6-5-7-10-14)22-18(16)12-17(15)20-4-2/h3-7,9-10,15-19H,1-2,8,11-13H2/t15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | HRGVITVDGAUHIJ-IEWDOMPSSA-N |
| XLogP | 4.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|