C27H32O5 — CID 11328036
(1S,3R,6R,8S,10R,12R,14S)-1-methyl-6-phenyl-14-phenylmethoxy-12-prop-2-enyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11328036) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is (1S,3R,6R,8S,10R,12R,14S)-1-methyl-6-phenyl-14-phenylmethoxy-12-prop-2-enyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (1S,3R,6R,8S,10R,12R,14S)-1-methyl-6-phenyl-14-phenylmethoxy-12-prop-2-enyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11328036 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (1S,3R,6R,8S,10R,12R,14S)-1-methyl-6-phenyl-14-phenylmethoxy-12-prop-2-enyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C=CC[C@@H]1C[C@H](OCc2ccccc2)[C@]2(C)O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3C[C@H]2O1 |
| InChI | InChI=1S/C27H32O5/c1-3-10-21-15-24(28-17-19-11-6-4-7-12-19)27(2)25(30-21)16-22-23(32-27)18-29-26(31-22)20-13-8-5-9-14-20/h3-9,11-14,21-26H,1,10,15-18H2,2H3/t21-,22+,23-,24+,25-,26-,27+/m1/s1 |
| InChIKey | QVUAAWQJPKIBNW-HQDBLNOUSA-N |
| XLogP | 4.97 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|