C21H32O5Si — CID 52916317
(2R,4aR,6R,7R,8aS)-6-methyl-2-phenyl-7-triethylsilyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-carbaldehyde (PubChem CID 52916317) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8aS)-6-methyl-2-phenyl-7-triethylsilyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-carbaldehyde.
| Compound Name | (2R,4aR,6R,7R,8aS)-6-methyl-2-phenyl-7-triethylsilyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-carbaldehyde |
|---|---|
| PubChem CID | 52916317 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2R,4aR,6R,7R,8aS)-6-methyl-2-phenyl-7-triethylsilyloxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-carbaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@@]1(C)C=O |
| InChI | InChI=1S/C21H32O5Si/c1-5-27(6-2,7-3)26-19-13-17-18(25-21(19,4)15-22)14-23-20(24-17)16-11-9-8-10-12-16/h8-12,15,17-20H,5-7,13-14H2,1-4H3/t17-,18+,19+,20+,21-/m0/s1 |
| InChIKey | KRFRDZDMLWMOKT-QSUVIHHLSA-N |
| XLogP | 4.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|